C24H35NO4 — CID 57012817
7-[(2R,3S)-1,3-dihydroxy-2-(1-methoxy-5-phenylpent-1-enyl)cyclopentyl]hept-5-enamide (PubChem CID 57012817) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is 7-[(2R,3S)-1,3-dihydroxy-2-(1-methoxy-5-phenylpent-1-enyl)cyclopentyl]hept-5-enamide.
| Compound Name | 7-[(2R,3S)-1,3-dihydroxy-2-(1-methoxy-5-phenylpent-1-enyl)cyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 57012817 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 7-[(2R,3S)-1,3-dihydroxy-2-(1-methoxy-5-phenylpent-1-enyl)cyclopentyl]hept-5-enamide |
| SMILES | COC(=CCCCc1ccccc1)[C@@H]1[C@@H](O)CCC1(O)CC=CCCCC(N)=O |
| InChI | InChI=1S/C24H35NO4/c1-29-21(14-9-8-13-19-11-5-4-6-12-19)23-20(26)16-18-24(23,28)17-10-3-2-7-15-22(25)27/h3-6,10-12,14,20,23,26,28H,2,7-9,13,15-18H2,1H3,(H2,25,27)/t20-,23-,24?/m0/s1 |
| InChIKey | WJHMXVSTFJISPO-AEPCKBASSA-N |
| XLogP | 3.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|