C24H35NO4 — CID 67584393
(Z)-2,2-dihydroxy-7-[(2R)-2-[(E)-1-methoxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enamide (PubChem CID 67584393) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is (Z)-2,2-dihydroxy-7-[(2R)-2-[(E)-1-methoxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enamide.
| Compound Name | (Z)-2,2-dihydroxy-7-[(2R)-2-[(E)-1-methoxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 67584393 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | (Z)-2,2-dihydroxy-7-[(2R)-2-[(E)-1-methoxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enamide |
| SMILES | CO/C(=C/CCCc1ccccc1)[C@@H]1CCCC1C/C=C\CCC(O)(O)C(N)=O |
| InChI | InChI=1S/C24H35NO4/c1-29-22(17-8-7-13-19-11-4-2-5-12-19)21-16-10-15-20(21)14-6-3-9-18-24(27,28)23(25)26/h2-6,11-12,17,20-21,27-28H,7-10,13-16,18H2,1H3,(H2,25,26)/b6-3-,22-17+/t20?,21-/m1/s1 |
| InChIKey | AQHHPUSVWXFYQL-XIBLSLQTSA-N |
| XLogP | 3.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|