C9H13NO4 — CID 110315779
methyl N-[3-(furan-2-yl)propoxy]carbamate (PubChem CID 110315779) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is methyl N-[3-(furan-2-yl)propoxy]carbamate.
| Compound Name | methyl N-[3-(furan-2-yl)propoxy]carbamate |
|---|---|
| PubChem CID | 110315779 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | methyl N-[3-(furan-2-yl)propoxy]carbamate |
| SMILES | COC(=O)NOCCCc1ccco1 |
| InChI | InChI=1S/C9H13NO4/c1-12-9(11)10-14-7-3-5-8-4-2-6-13-8/h2,4,6H,3,5,7H2,1H3,(H,10,11) |
| InChIKey | ZJASTNFRYYSJOW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|