C14H13BrClNO3 — CID 110634306
3-bromo-5-chloro-N-[3-(furan-2-yl)propoxy]benzamide (PubChem CID 110634306) has the molecular formula C14H13BrClNO3 and a molecular weight of 358.62 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[3-(furan-2-yl)propoxy]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[3-(furan-2-yl)propoxy]benzamide |
|---|---|
| PubChem CID | 110634306 |
| Molecular Formula | C14H13BrClNO3 |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 3-bromo-5-chloro-N-[3-(furan-2-yl)propoxy]benzamide |
| SMILES | O=C(NOCCCc1ccco1)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C14H13BrClNO3/c15-11-7-10(8-12(16)9-11)14(18)17-20-6-2-4-13-3-1-5-19-13/h1,3,5,7-9H,2,4,6H2,(H,17,18) |
| InChIKey | LBKPUIXLKIALSQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|