C21H22N2O3 — CID 110634206
N-[3-(furan-2-yl)propoxy]-2-phenyl-3-pyridin-4-ylpropanamide (PubChem CID 110634206) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[3-(furan-2-yl)propoxy]-2-phenyl-3-pyridin-4-ylpropanamide.
| Compound Name | N-[3-(furan-2-yl)propoxy]-2-phenyl-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 110634206 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[3-(furan-2-yl)propoxy]-2-phenyl-3-pyridin-4-ylpropanamide |
| SMILES | O=C(NOCCCc1ccco1)C(Cc1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O3/c24-21(23-26-15-5-9-19-8-4-14-25-19)20(18-6-2-1-3-7-18)16-17-10-12-22-13-11-17/h1-4,6-8,10-14,20H,5,9,15-16H2,(H,23,24) |
| InChIKey | IJRRBWBAZGTYSZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|