C17H20O2S — CID 88622330
7-(furan-2-yl)-2-phenylheptanethioic S-acid (PubChem CID 88622330) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is 7-(furan-2-yl)-2-phenylheptanethioic S-acid.
| Compound Name | 7-(furan-2-yl)-2-phenylheptanethioic S-acid |
|---|---|
| PubChem CID | 88622330 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 7-(furan-2-yl)-2-phenylheptanethioic S-acid |
| SMILES | O=C(S)C(CCCCCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C17H20O2S/c18-17(20)16(14-8-3-1-4-9-14)12-6-2-5-10-15-11-7-13-19-15/h1,3-4,7-9,11,13,16H,2,5-6,10,12H2,(H,18,20) |
| InChIKey | BQNULMKIGLWKRC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 30.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|