C11H15NO5 — CID 164839099
furan-2-ylmethyl 4-(methoxycarbonylamino)butanoate (PubChem CID 164839099) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is furan-2-ylmethyl 4-(methoxycarbonylamino)butanoate.
| Compound Name | furan-2-ylmethyl 4-(methoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 164839099 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | furan-2-ylmethyl 4-(methoxycarbonylamino)butanoate |
| SMILES | COC(=O)NCCCC(=O)OCc1ccco1 |
| InChI | InChI=1S/C11H15NO5/c1-15-11(14)12-6-2-5-10(13)17-8-9-4-3-7-16-9/h3-4,7H,2,5-6,8H2,1H3,(H,12,14) |
| InChIKey | SPRMMUFQCREZHD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|