About furan-2-ylmethyl 2-(methylamino)acetate
furan-2-ylmethyl 2-(methylamino)acetate (PubChem CID 70320956) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is furan-2-ylmethyl 2-(methylamino)acetate.
Molecular Properties
| Compound Name | furan-2-ylmethyl 2-(methylamino)acetate |
| PubChem CID | 70320956 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | furan-2-ylmethyl 2-(methylamino)acetate |
| SMILES | CNCC(=O)OCc1ccco1 |
| InChI | InChI=1S/C8H11NO3/c1-9-5-8(10)12-6-7-3-2-4-11-7/h2-4,9H,5-6H2,1H3 |
| InChIKey | XAFMWYWFGGKFOJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furan-2-ylmethyl 2-(methylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl 2-(methylamino)acetate?
The IUPAC name of furan-2-ylmethyl 2-(methylamino)acetate (CID 70320956) is furan-2-ylmethyl 2-(methylamino)acetate.
What is the SMILES notation for furan-2-ylmethyl 2-(methylamino)acetate?
The canonical SMILES for furan-2-ylmethyl 2-(methylamino)acetate is CNCC(=O)OCc1ccco1.
What is the InChIKey of furan-2-ylmethyl 2-(methylamino)acetate?
The InChIKey is XAFMWYWFGGKFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-9-5-8(10)12-6-7-3-2-4-11-7/h2-4,9H,5-6H2,1H3.
What are the key properties of furan-2-ylmethyl 2-(methylamino)acetate?
furan-2-ylmethyl 2-(methylamino)acetate has a molecular weight of 169.18 g/mol, XLogP of 0.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl 2-(methylamino)acetate is sourced from PubChem (CID 70320956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).