About furan-2-ylmethyl 4-sulfanylbutanoate
furan-2-ylmethyl 4-sulfanylbutanoate (PubChem CID 89395798) has the molecular formula C9H12O3S
and a molecular weight of 200.26 g/mol. Its IUPAC name is furan-2-ylmethyl 4-sulfanylbutanoate.
Molecular Properties
| Compound Name | furan-2-ylmethyl 4-sulfanylbutanoate |
| PubChem CID | 89395798 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | furan-2-ylmethyl 4-sulfanylbutanoate |
| SMILES | O=C(CCCS)OCc1ccco1 |
| InChI | InChI=1S/C9H12O3S/c10-9(4-2-6-13)12-7-8-3-1-5-11-8/h1,3,5,13H,2,4,6-7H2 |
| InChIKey | GUFCQGCLGRMYBU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 39.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze furan-2-ylmethyl 4-sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl 4-sulfanylbutanoate?
The IUPAC name of furan-2-ylmethyl 4-sulfanylbutanoate (CID 89395798) is furan-2-ylmethyl 4-sulfanylbutanoate.
What is the SMILES notation for furan-2-ylmethyl 4-sulfanylbutanoate?
The canonical SMILES for furan-2-ylmethyl 4-sulfanylbutanoate is O=C(CCCS)OCc1ccco1.
What is the InChIKey of furan-2-ylmethyl 4-sulfanylbutanoate?
The InChIKey is GUFCQGCLGRMYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S/c10-9(4-2-6-13)12-7-8-3-1-5-11-8/h1,3,5,13H,2,4,6-7H2.
What are the key properties of furan-2-ylmethyl 4-sulfanylbutanoate?
furan-2-ylmethyl 4-sulfanylbutanoate has a molecular weight of 200.26 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl 4-sulfanylbutanoate is sourced from PubChem (CID 89395798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).