C19H28O5 — CID 70461055
methyl 14-(furan-2-yl)-5,12-dihydroxytetradeca-6,10-dienoate (PubChem CID 70461055) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is methyl 14-(furan-2-yl)-5,12-dihydroxytetradeca-6,10-dienoate.
| Compound Name | methyl 14-(furan-2-yl)-5,12-dihydroxytetradeca-6,10-dienoate |
|---|---|
| PubChem CID | 70461055 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | methyl 14-(furan-2-yl)-5,12-dihydroxytetradeca-6,10-dienoate |
| SMILES | COC(=O)CCCC(O)C=CCCC=CC(O)CCc1ccco1 |
| InChI | InChI=1S/C19H28O5/c1-23-19(22)12-6-10-16(20)8-4-2-3-5-9-17(21)13-14-18-11-7-15-24-18/h4-5,7-9,11,15-17,20-21H,2-3,6,10,12-14H2,1H3 |
| InChIKey | FTPRWKAIOMMZNJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|