About methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate
methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate (PubChem CID 163047395) has the molecular formula C22H30O4
and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate.
Molecular Properties
| Compound Name | methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate |
| PubChem CID | 163047395 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate |
| SMILES | COC(=O)CC(C)CCCC(C)=CCCc1coc(Cc2ccco2)c1 |
| InChI | InChI=1S/C22H30O4/c1-17(7-4-9-18(2)13-22(23)24-3)8-5-10-19-14-21(26-16-19)15-20-11-6-12-25-20/h6,8,11-12,14,16,18H,4-5,7,9-10,13,15H2,1-3H3 |
| InChIKey | LLSOQDIXKJXJRD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate?
The IUPAC name of methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate (CID 163047395) is methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate.
What is the SMILES notation for methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate?
The canonical SMILES for methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate is COC(=O)CC(C)CCCC(C)=CCCc1coc(Cc2ccco2)c1.
What is the InChIKey of methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate?
The InChIKey is LLSOQDIXKJXJRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O4/c1-17(7-4-9-18(2)13-22(23)24-3)8-5-10-19-14-21(26-16-19)15-20-11-6-12-25-20/h6,8,11-12,14,16,18H,4-5,7,9-10,13,15H2,1-3H3.
What are the key properties of methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate?
methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate has a molecular weight of 358.48 g/mol, XLogP of 5.71, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate is sourced from PubChem (CID 163047395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).