C22H30O4 — CID 163047395
methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate (PubChem CID 163047395) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate.
| Compound Name | methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate |
|---|---|
| PubChem CID | 163047395 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl 10-[5-(furan-2-ylmethyl)furan-3-yl]-3,7-dimethyldec-7-enoate |
| SMILES | COC(=O)CC(C)CCCC(C)=CCCc1coc(Cc2ccco2)c1 |
| InChI | InChI=1S/C22H30O4/c1-17(7-4-9-18(2)13-22(23)24-3)8-5-10-19-14-21(26-16-19)15-20-11-6-12-25-20/h6,8,11-12,14,16,18H,4-5,7,9-10,13,15H2,1-3H3 |
| InChIKey | LLSOQDIXKJXJRD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|