C19H34O2Si — CID 10615855
2,3-dimethylbutan-2-yl-[(E)-6-(furan-2-yl)-3-methylhex-3-enoxy]-dimethylsilane (PubChem CID 10615855) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[(E)-6-(furan-2-yl)-3-methylhex-3-enoxy]-dimethylsilane.
| Compound Name | 2,3-dimethylbutan-2-yl-[(E)-6-(furan-2-yl)-3-methylhex-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10615855 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[(E)-6-(furan-2-yl)-3-methylhex-3-enoxy]-dimethylsilane |
| SMILES | C/C(=C\CCc1ccco1)CCO[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-16(2)19(4,5)22(6,7)21-15-13-17(3)10-8-11-18-12-9-14-20-18/h9-10,12,14,16H,8,11,13,15H2,1-7H3/b17-10+ |
| InChIKey | JUXBGEYMQWVGAF-LICLKQGHSA-N |
| XLogP | 6.21 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|