C13H18N4O3 — CID 62860172
N-[4-(furan-2-yl)butan-2-yl]-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 62860172) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[4-(furan-2-yl)butan-2-yl]-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[4-(furan-2-yl)butan-2-yl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62860172 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[4-(furan-2-yl)butan-2-yl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NC(C)CCc2ccco2)nc(OC)n1 |
| InChI | InChI=1S/C13H18N4O3/c1-9(6-7-10-5-4-8-20-10)14-11-15-12(18-2)17-13(16-11)19-3/h4-5,8-9H,6-7H2,1-3H3,(H,14,15,16,17) |
| InChIKey | FMBZBZZHUKSOTO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |