C9H17N5O2 — CID 83178530
3-N-(4,6-dimethoxy-1,3,5-triazin-2-yl)butane-1,3-diamine (PubChem CID 83178530) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-N-(4,6-dimethoxy-1,3,5-triazin-2-yl)butane-1,3-diamine.
| Compound Name | 3-N-(4,6-dimethoxy-1,3,5-triazin-2-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 83178530 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3-N-(4,6-dimethoxy-1,3,5-triazin-2-yl)butane-1,3-diamine |
| SMILES | COc1nc(NC(C)CCN)nc(OC)n1 |
| InChI | InChI=1S/C9H17N5O2/c1-6(4-5-10)11-7-12-8(15-2)14-9(13-7)16-3/h6H,4-5,10H2,1-3H3,(H,11,12,13,14) |
| InChIKey | HBUGBMJCVJKCQN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |