C38H52O6 — CID 161176679
methyl 3-methyl-4-phenylbutanoate;methyl 3-methyl-6-phenylhexanoate;6-phenylhexanoic acid (PubChem CID 161176679) has the molecular formula C38H52O6 and a molecular weight of 604.83 g/mol. Its IUPAC name is methyl 3-methyl-4-phenylbutanoate;methyl 3-methyl-6-phenylhexanoate;6-phenylhexanoic acid.
| Compound Name | methyl 3-methyl-4-phenylbutanoate;methyl 3-methyl-6-phenylhexanoate;6-phenylhexanoic acid |
|---|---|
| PubChem CID | 161176679 |
| Molecular Formula | C38H52O6 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | methyl 3-methyl-4-phenylbutanoate;methyl 3-methyl-6-phenylhexanoate;6-phenylhexanoic acid |
| SMILES | COC(=O)CC(C)CCCc1ccccc1.COC(=O)CC(C)Cc1ccccc1.O=C(O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C14H20O2.2C12H16O2/c1-12(11-14(15)16-2)7-6-10-13-8-4-3-5-9-13;1-10(9-12(13)14-2)8-11-6-4-3-5-7-11;13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h3-5,8-9,12H,6-7,10-11H2,1-2H3;3-7,10H,8-9H2,1-2H3;1,3-4,7-8H,2,5-6,9-10H2,(H,13,14) |
| InChIKey | URXGFGAKNDTKEC-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|