About [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate
[(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate (PubChem CID 70251428) has the molecular formula C26H34O3
and a molecular weight of 394.56 g/mol. Its IUPAC name is [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate.
Molecular Properties
| Compound Name | [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate |
| PubChem CID | 70251428 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate |
| SMILES | C[C@@H](COC(=O)CC(=O)CCCCCCCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H34O3/c1-22(19-24-16-10-6-11-17-24)21-29-26(28)20-25(27)18-12-4-2-3-7-13-23-14-8-5-9-15-23/h5-6,8-11,14-17,22H,2-4,7,12-13,18-21H2,1H3/t22-/m1/s1 |
| InChIKey | XKCOOODIBAJTLI-JOCHJYFZSA-N |
| XLogP | 5.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate?
The IUPAC name of [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate (CID 70251428) is [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate.
What is the SMILES notation for [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate?
The canonical SMILES for [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate is C[C@@H](COC(=O)CC(=O)CCCCCCCc1ccccc1)Cc1ccccc1.
What is the InChIKey of [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate?
The InChIKey is XKCOOODIBAJTLI-JOCHJYFZSA-N. The full InChI is InChI=1S/C26H34O3/c1-22(19-24-16-10-6-11-17-24)21-29-26(28)20-25(27)18-12-4-2-3-7-13-23-14-8-5-9-15-23/h5-6,8-11,14-17,22H,2-4,7,12-13,18-21H2,1H3/t22-/m1/s1.
What are the key properties of [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate?
[(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate has a molecular weight of 394.56 g/mol, XLogP of 5.95, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-methyl-3-phenylpropyl] 3-oxo-10-phenyldecanoate is sourced from PubChem (CID 70251428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).