C25H30O8S — CID 162800770
[2-[9-[5-(furan-3-ylmethyl)furan-3-yl]-2,6-dimethylnon-5-enylidene]-4-methyl-5-oxofuran-3-yl] hydrogen sulfate (PubChem CID 162800770) has the molecular formula C25H30O8S and a molecular weight of 490.57 g/mol. Its IUPAC name is [2-[9-[5-(furan-3-ylmethyl)furan-3-yl]-2,6-dimethylnon-5-enylidene]-4-methyl-5-oxofuran-3-yl] hydrogen sulfate.
| Compound Name | [2-[9-[5-(furan-3-ylmethyl)furan-3-yl]-2,6-dimethylnon-5-enylidene]-4-methyl-5-oxofuran-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 162800770 |
| Molecular Formula | C25H30O8S |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [2-[9-[5-(furan-3-ylmethyl)furan-3-yl]-2,6-dimethylnon-5-enylidene]-4-methyl-5-oxofuran-3-yl] hydrogen sulfate |
| SMILES | CC(=CCCC(C)C=C1OC(=O)C(C)=C1OS(=O)(=O)O)CCCc1coc(Cc2ccoc2)c1 |
| InChI | InChI=1S/C25H30O8S/c1-17(7-5-9-20-13-22(31-16-20)14-21-10-11-30-15-21)6-4-8-18(2)12-23-24(33-34(27,28)29)19(3)25(26)32-23/h6,10-13,15-16,18H,4-5,7-9,14H2,1-3H3,(H,27,28,29) |
| InChIKey | BAGSGDQKWIKGAE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|