C45H72O5 — CID 102075941
[(2Z)-2-[(2S,6E,10E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-6,10-dienylidene]-4-methyl-5-oxofuran-3-yl] 2,11-dimethyloctadecanoate (PubChem CID 102075941) has the molecular formula C45H72O5 and a molecular weight of 693.07 g/mol. Its IUPAC name is [(2Z)-2-[(2S,6E,10E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-6,10-dienylidene]-4-methyl-5-oxofuran-3-yl] 2,11-dimethyloctadecanoate.
| Compound Name | [(2Z)-2-[(2S,6E,10E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-6,10-dienylidene]-4-methyl-5-oxofuran-3-yl] 2,11-dimethyloctadecanoate |
|---|---|
| PubChem CID | 102075941 |
| Molecular Formula | C45H72O5 |
| Molecular Weight | 693.07 g/mol |
| Exact Mass | 692.54 |
| IUPAC Name | [(2Z)-2-[(2S,6E,10E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-6,10-dienylidene]-4-methyl-5-oxofuran-3-yl] 2,11-dimethyloctadecanoate |
| SMILES | CCCCCCCC(C)CCCCCCCCC(C)C(=O)OC1=C(C)C(=O)O/C1=C\[C@@H](C)CCC/C(C)=C/CC/C(C)=C/CCc1ccoc1 |
| InChI | InChI=1S/C45H72O5/c1-8-9-10-13-16-22-35(2)23-17-14-11-12-15-18-29-39(6)44(46)50-43-40(7)45(47)49-42(43)33-38(5)28-20-26-36(3)24-19-25-37(4)27-21-30-41-31-32-48-34-41/h24,27,31-35,38-39H,8-23,25-26,28-30H2,1-7H3/b36-24+,37-27+,42-33-/t35?,38-,39?/m0/s1 |
| InChIKey | QBJKCKCMMTXZGR-UREHIDJQSA-N |
| XLogP | 13.70 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.07 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|