C25H34O4 — CID 163031801
(5Z)-5-[(E,2R,6S)-13-(furan-3-yl)-2,6,10-trimethyl-5-oxotridec-10-enylidene]-3-methylfuran-2-one (PubChem CID 163031801) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is (5Z)-5-[(E,2R,6S)-13-(furan-3-yl)-2,6,10-trimethyl-5-oxotridec-10-enylidene]-3-methylfuran-2-one.
| Compound Name | (5Z)-5-[(E,2R,6S)-13-(furan-3-yl)-2,6,10-trimethyl-5-oxotridec-10-enylidene]-3-methylfuran-2-one |
|---|---|
| PubChem CID | 163031801 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (5Z)-5-[(E,2R,6S)-13-(furan-3-yl)-2,6,10-trimethyl-5-oxotridec-10-enylidene]-3-methylfuran-2-one |
| SMILES | CC1=C/C(=C/[C@H](C)CCC(=O)[C@@H](C)CCC/C(C)=C/CCc2ccoc2)OC1=O |
| InChI | InChI=1S/C25H34O4/c1-18(8-6-10-22-13-14-28-17-22)7-5-9-20(3)24(26)12-11-19(2)15-23-16-21(4)25(27)29-23/h8,13-17,19-20H,5-7,9-12H2,1-4H3/b18-8+,23-15-/t19-,20+/m1/s1 |
| InChIKey | WCORUTPTIYDINC-JCRIZCNVSA-N |
| XLogP | 6.34 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|