C25H34O7S — CID 163169834
[(2Z)-2-[(2S,6S,7E,10E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-7,10-dienylidene]-4-methyl-5-oxofuran-3-yl] hydrogen sulfate (PubChem CID 163169834) has the molecular formula C25H34O7S and a molecular weight of 478.61 g/mol. Its IUPAC name is [(2Z)-2-[(2S,6S,7E,10E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-7,10-dienylidene]-4-methyl-5-oxofuran-3-yl] hydrogen sulfate.
| Compound Name | [(2Z)-2-[(2S,6S,7E,10E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-7,10-dienylidene]-4-methyl-5-oxofuran-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 163169834 |
| Molecular Formula | C25H34O7S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(2Z)-2-[(2S,6S,7E,10E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-7,10-dienylidene]-4-methyl-5-oxofuran-3-yl] hydrogen sulfate |
| SMILES | CC1=C(OS(=O)(=O)O)/C(=C/[C@@H](C)CCC[C@H](C)/C=C/C/C(C)=C/CCc2ccoc2)OC1=O |
| InChI | InChI=1S/C25H34O7S/c1-18(8-5-9-19(2)11-7-13-22-14-15-30-17-22)10-6-12-20(3)16-23-24(32-33(27,28)29)21(4)25(26)31-23/h5,8,11,14-18,20H,6-7,9-10,12-13H2,1-4H3,(H,27,28,29)/b8-5+,19-11+,23-16-/t18-,20+/m1/s1 |
| InChIKey | UXDZHOYEBALGMZ-XTZQTSFTSA-N |
| XLogP | 6.08 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|