C19H36O5Si — CID 70399511
(Z)-7-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-1,3-dioxan-5-yl]hept-5-enoic acid (PubChem CID 70399511) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (Z)-7-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-1,3-dioxan-5-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-1,3-dioxan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70399511 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (Z)-7-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-1,3-dioxan-5-yl]hept-5-enoic acid |
| SMILES | CC1(CO[Si](C)(C)C(C)(C)C)OCC(C/C=C\CCCC(=O)O)CO1 |
| InChI | InChI=1S/C19H36O5Si/c1-18(2,3)25(5,6)24-15-19(4)22-13-16(14-23-19)11-9-7-8-10-12-17(20)21/h7,9,16H,8,10-15H2,1-6H3,(H,20,21)/b9-7- |
| InChIKey | LCCSQXXRKFDQPH-CLFYSBASSA-N |
| XLogP | 4.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|