C16H27NO5 — CID 11109786
(Z)-6-[(4R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]hex-5-enoic acid (PubChem CID 11109786) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is (Z)-6-[(4R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(4R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 11109786 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (Z)-6-[(4R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]hex-5-enoic acid |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C\CCCC(=O)O)COC1(C)C |
| InChI | InChI=1S/C16H27NO5/c1-15(2,3)22-14(20)17-12(11-21-16(17,4)5)9-7-6-8-10-13(18)19/h7,9,12H,6,8,10-11H2,1-5H3,(H,18,19)/b9-7-/t12-/m1/s1 |
| InChIKey | SFAGUYIHAXJARV-ZVTBTPLYSA-N |
| XLogP | 3.17 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|