C26H51NO4Sn — CID 14660993
tert-butyl (4R)-2,2-dimethyl-4-[(Z)-3-(tributylstannylmethoxy)prop-1-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 14660993) has the molecular formula C26H51NO4Sn and a molecular weight of 560.41 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(Z)-3-(tributylstannylmethoxy)prop-1-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(Z)-3-(tributylstannylmethoxy)prop-1-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 14660993 |
| Molecular Formula | C26H51NO4Sn |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(Z)-3-(tributylstannylmethoxy)prop-1-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)COC/C=C\[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24NO4.3C4H9.Sn/c1-13(2,3)19-12(16)15-11(8-7-9-17-6)10-18-14(15,4)5;3*1-3-4-2;/h7-8,11H,6,9-10H2,1-5H3;3*1,3-4H2,2H3;/b8-7-;;;;/t11-;;;;/m1..../s1 |
| InChIKey | SBIZROGTRICUCA-RTRXQSMHSA-N |
| XLogP | 7.32 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|