C16H28BrNO3 — CID 67918992
tert-butyl (4R)-4-(5-bromo-2-methylpent-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 67918992) has the molecular formula C16H28BrNO3 and a molecular weight of 362.31 g/mol. Its IUPAC name is tert-butyl (4R)-4-(5-bromo-2-methylpent-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-(5-bromo-2-methylpent-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 67918992 |
| Molecular Formula | C16H28BrNO3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | tert-butyl (4R)-4-(5-bromo-2-methylpent-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(=C[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)CCCBr |
| InChI | InChI=1S/C16H28BrNO3/c1-12(8-7-9-17)10-13-11-20-16(5,6)18(13)14(19)21-15(2,3)4/h10,13H,7-9,11H2,1-6H3/t13-/m1/s1 |
| InChIKey | ZHWBMQAWOKULFF-CYBMUJFWSA-N |
| XLogP | 4.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|