C13H21BrFNO3 — CID 638993
tert-butyl (4R)-4-[(Z)-3-bromo-2-fluoroprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 638993) has the molecular formula C13H21BrFNO3 and a molecular weight of 338.22 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(Z)-3-bromo-2-fluoroprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(Z)-3-bromo-2-fluoroprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 638993 |
| Molecular Formula | C13H21BrFNO3 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | tert-butyl (4R)-4-[(Z)-3-bromo-2-fluoroprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C(\F)CBr)COC1(C)C |
| InChI | InChI=1S/C13H21BrFNO3/c1-12(2,3)19-11(17)16-10(6-9(15)7-14)8-18-13(16,4)5/h6,10H,7-8H2,1-5H3/b9-6-/t10-/m1/s1 |
| InChIKey | LVURESXRRRTUEM-ABRRARGCSA-N |
| XLogP | 3.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|