C34H50O6 — CID 159063058
(6Z,8aR,9R,10R,11aS)-10-methyl-9-[(E,3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one;oxan-2-ol (PubChem CID 159063058) has the molecular formula C34H50O6 and a molecular weight of 554.77 g/mol. Its IUPAC name is (6Z,8aR,9R,10R,11aS)-10-methyl-9-[(E,3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one;oxan-2-ol.
| Compound Name | (6Z,8aR,9R,10R,11aS)-10-methyl-9-[(E,3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one;oxan-2-ol |
|---|---|
| PubChem CID | 159063058 |
| Molecular Formula | C34H50O6 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | (6Z,8aR,9R,10R,11aS)-10-methyl-9-[(E,3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one;oxan-2-ol |
| SMILES | C[C@@H]1C[C@@H]2OC(=O)CCC/C=C\C[C@@H]2[C@H]1/C=C/[C@H](CCc1ccccc1)OC1CCCCO1.OC1CCCCO1 |
| InChI | InChI=1S/C29H40O4.C5H10O2/c1-22-21-27-26(13-7-2-3-8-14-28(30)33-27)25(22)19-18-24(32-29-15-9-10-20-31-29)17-16-23-11-5-4-6-12-23;6-5-3-1-2-4-7-5/h2,4-7,11-12,18-19,22,24-27,29H,3,8-10,13-17,20-21H2,1H3;5-6H,1-4H2/b7-2-,19-18+;/t22-,24+,25+,26-,27+,29?;/m1./s1 |
| InChIKey | JYSDYWLAXQACJW-VFCIEQQZSA-N |
| XLogP | 6.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|