C22H27F3N2O3 — CID 100945989
2-[6-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenoxy]hexyl]propane-1,3-diol (PubChem CID 100945989) has the molecular formula C22H27F3N2O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[6-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenoxy]hexyl]propane-1,3-diol.
| Compound Name | 2-[6-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenoxy]hexyl]propane-1,3-diol |
|---|---|
| PubChem CID | 100945989 |
| Molecular Formula | C22H27F3N2O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-[6-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenoxy]hexyl]propane-1,3-diol |
| SMILES | OCC(CO)CCCCCCOc1ccc(/N=N/c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H27F3N2O3/c23-22(24,25)18-6-8-19(9-7-18)26-27-20-10-12-21(13-11-20)30-14-4-2-1-3-5-17(15-28)16-29/h6-13,17,28-29H,1-5,14-16H2/b27-26+ |
| InChIKey | QGXLHPIKOYHGTH-CYYJNZCTSA-N |
| XLogP | 6.05 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|