C22H27N3O3 — CID 100923837
4-[[4-[8,8-dideuterio-7-[dideuterio(hydroxy)methyl]-8-hydroxyoctoxy]phenyl]diazenyl]benzonitrile (PubChem CID 100923837) has the molecular formula C22H27N3O3 and a molecular weight of 385.50 g/mol. Its IUPAC name is 4-[[4-[8,8-dideuterio-7-[dideuterio(hydroxy)methyl]-8-hydroxyoctoxy]phenyl]diazenyl]benzonitrile.
| Compound Name | 4-[[4-[8,8-dideuterio-7-[dideuterio(hydroxy)methyl]-8-hydroxyoctoxy]phenyl]diazenyl]benzonitrile |
|---|---|
| PubChem CID | 100923837 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-[[4-[8,8-dideuterio-7-[dideuterio(hydroxy)methyl]-8-hydroxyoctoxy]phenyl]diazenyl]benzonitrile |
| SMILES | [2H]C([2H])(O)C(CCCCCCOc1ccc(/N=N/c2ccc(C#N)cc2)cc1)C([2H])([2H])O |
| InChI | InChI=1S/C22H27N3O3/c23-15-18-6-8-20(9-7-18)24-25-21-10-12-22(13-11-21)28-14-4-2-1-3-5-19(16-26)17-27/h6-13,19,26-27H,1-5,14,16-17H2/b25-24+/i16D2,17D2 |
| InChIKey | ZEPLHQNAEHPGPW-QFBUAFEVSA-N |
| XLogP | 4.90 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|