C16H15N3O3 — CID 71356146
4-[[4-(2,3-dihydroxypropoxy)phenyl]diazenyl]benzonitrile (PubChem CID 71356146) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[[4-(2,3-dihydroxypropoxy)phenyl]diazenyl]benzonitrile.
| Compound Name | 4-[[4-(2,3-dihydroxypropoxy)phenyl]diazenyl]benzonitrile |
|---|---|
| PubChem CID | 71356146 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-[[4-(2,3-dihydroxypropoxy)phenyl]diazenyl]benzonitrile |
| SMILES | N#Cc1ccc(/N=N/c2ccc(OCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C16H15N3O3/c17-9-12-1-3-13(4-2-12)18-19-14-5-7-16(8-6-14)22-11-15(21)10-20/h1-8,15,20-21H,10-11H2/b19-18+ |
| InChIKey | QPNOJHQROLXSKB-VHEBQXMUSA-N |
| XLogP | 2.71 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|