C11H12F3NOS — CID 43175370
2-methyl-3-[4-(trifluoromethyl)phenoxy]propanethioamide (PubChem CID 43175370) has the molecular formula C11H12F3NOS and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-methyl-3-[4-(trifluoromethyl)phenoxy]propanethioamide.
| Compound Name | 2-methyl-3-[4-(trifluoromethyl)phenoxy]propanethioamide |
|---|---|
| PubChem CID | 43175370 |
| Molecular Formula | C11H12F3NOS |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-methyl-3-[4-(trifluoromethyl)phenoxy]propanethioamide |
| SMILES | CC(COc1ccc(C(F)(F)F)cc1)C(N)=S |
| InChI | InChI=1S/C11H12F3NOS/c1-7(10(15)17)6-16-9-4-2-8(3-5-9)11(12,13)14/h2-5,7H,6H2,1H3,(H2,15,17) |
| InChIKey | DHRHNGXQWSHDMH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|