C22H28O5S — CID 70967247
2-[4-[4-methoxy-2-[(4-methylphenoxy)methyl]butyl]sulfanyl-2-methylphenoxy]acetic acid (PubChem CID 70967247) has the molecular formula C22H28O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is 2-[4-[4-methoxy-2-[(4-methylphenoxy)methyl]butyl]sulfanyl-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[4-methoxy-2-[(4-methylphenoxy)methyl]butyl]sulfanyl-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 70967247 |
| Molecular Formula | C22H28O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[4-[4-methoxy-2-[(4-methylphenoxy)methyl]butyl]sulfanyl-2-methylphenoxy]acetic acid |
| SMILES | COCCC(COc1ccc(C)cc1)CSc1ccc(OCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C22H28O5S/c1-16-4-6-19(7-5-16)26-13-18(10-11-25-3)15-28-20-8-9-21(17(2)12-20)27-14-22(23)24/h4-9,12,18H,10-11,13-15H2,1-3H3,(H,23,24) |
| InChIKey | KRHNCQQCLFBSFF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |