C19H21FO4S — CID 70991105
2-[4-[2-[4-(fluoromethyl)phenoxy]propylsulfanyl]-2-methylphenoxy]acetic acid (PubChem CID 70991105) has the molecular formula C19H21FO4S and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[4-[2-[4-(fluoromethyl)phenoxy]propylsulfanyl]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[2-[4-(fluoromethyl)phenoxy]propylsulfanyl]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 70991105 |
| Molecular Formula | C19H21FO4S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[4-[2-[4-(fluoromethyl)phenoxy]propylsulfanyl]-2-methylphenoxy]acetic acid |
| SMILES | Cc1cc(SCC(C)Oc2ccc(CF)cc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C19H21FO4S/c1-13-9-17(7-8-18(13)23-11-19(21)22)25-12-14(2)24-16-5-3-15(10-20)4-6-16/h3-9,14H,10-12H2,1-2H3,(H,21,22) |
| InChIKey | BVUDZAMEBHLVNK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |