C21H23F3O7S — CID 59001989
2-[1-[4-(2-hydroperoxyethoxy)-3-methylphenyl]sulfanyl-3-[4-(trifluoromethyl)phenoxy]propan-2-yl]oxyacetic acid (PubChem CID 59001989) has the molecular formula C21H23F3O7S and a molecular weight of 476.47 g/mol. Its IUPAC name is 2-[1-[4-(2-hydroperoxyethoxy)-3-methylphenyl]sulfanyl-3-[4-(trifluoromethyl)phenoxy]propan-2-yl]oxyacetic acid.
| Compound Name | 2-[1-[4-(2-hydroperoxyethoxy)-3-methylphenyl]sulfanyl-3-[4-(trifluoromethyl)phenoxy]propan-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 59001989 |
| Molecular Formula | C21H23F3O7S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[1-[4-(2-hydroperoxyethoxy)-3-methylphenyl]sulfanyl-3-[4-(trifluoromethyl)phenoxy]propan-2-yl]oxyacetic acid |
| SMILES | Cc1cc(SCC(COc2ccc(C(F)(F)F)cc2)OCC(=O)O)ccc1OCCOO |
| InChI | InChI=1S/C21H23F3O7S/c1-14-10-18(6-7-19(14)28-8-9-31-27)32-13-17(30-12-20(25)26)11-29-16-4-2-15(3-5-16)21(22,23)24/h2-7,10,17,27H,8-9,11-13H2,1H3,(H,25,26) |
| InChIKey | GDTFNYBLWKNDAX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|