C30H46F3NO2 — CID 159903334
[4-butyl-1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]piperidin-4-yl] 3-methylbutanoate (PubChem CID 159903334) has the molecular formula C30H46F3NO2 and a molecular weight of 509.70 g/mol. Its IUPAC name is [4-butyl-1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]piperidin-4-yl] 3-methylbutanoate.
| Compound Name | [4-butyl-1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]piperidin-4-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 159903334 |
| Molecular Formula | C30H46F3NO2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.35 |
| IUPAC Name | [4-butyl-1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]piperidin-4-yl] 3-methylbutanoate |
| SMILES | CCCCC1(OC(=O)CC(C)C)CCN(C(C=C(C)C)CC(C)(C)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C30H46F3NO2/c1-8-9-14-29(36-27(35)20-23(4)5)15-17-34(18-16-29)26(19-22(2)3)21-28(6,7)24-10-12-25(13-11-24)30(31,32)33/h10-13,19,23,26H,8-9,14-18,20-21H2,1-7H3 |
| InChIKey | QWFZFXBCTSXIJV-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|