About ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate
ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate (PubChem CID 167106669) has the molecular formula C25H36F3NO2
and a molecular weight of 439.56 g/mol. Its IUPAC name is ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate |
| PubChem CID | 167106669 |
| Molecular Formula | C25H36F3NO2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(C=C(C)C)CC(C)(C)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H36F3NO2/c1-6-31-23(30)29-14-7-8-19(13-15-29)20(16-18(2)3)17-24(4,5)21-9-11-22(12-10-21)25(26,27)28/h9-12,16,19-20H,6-8,13-15,17H2,1-5H3 |
| InChIKey | FWFFNMTYAYZTPS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate?
The IUPAC name of ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate (CID 167106669) is ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate.
What is the SMILES notation for ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate?
The canonical SMILES for ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate is CCOC(=O)N1CCCC(C(C=C(C)C)CC(C)(C)c2ccc(C(F)(F)F)cc2)CC1.
What is the InChIKey of ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate?
The InChIKey is FWFFNMTYAYZTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36F3NO2/c1-6-31-23(30)29-14-7-8-19(13-15-29)20(16-18(2)3)17-24(4,5)21-9-11-22(12-10-21)25(26,27)28/h9-12,16,19-20H,6-8,13-15,17H2,1-5H3.
What are the key properties of ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate?
ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate has a molecular weight of 439.56 g/mol, XLogP of 7.21, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate is sourced from PubChem (CID 167106669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).