C25H36F3NO2 — CID 167106669
ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate (PubChem CID 167106669) has the molecular formula C25H36F3NO2 and a molecular weight of 439.56 g/mol. Its IUPAC name is ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate.
| Compound Name | ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 167106669 |
| Molecular Formula | C25H36F3NO2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | ethyl 4-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(C=C(C)C)CC(C)(C)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H36F3NO2/c1-6-31-23(30)29-14-7-8-19(13-15-29)20(16-18(2)3)17-24(4,5)21-9-11-22(12-10-21)25(26,27)28/h9-12,16,19-20H,6-8,13-15,17H2,1-5H3 |
| InChIKey | FWFFNMTYAYZTPS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|