C22H22F6N2O2 — CID 18348177
ethyl 4-[bis[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 18348177) has the molecular formula C22H22F6N2O2 and a molecular weight of 460.42 g/mol. Its IUPAC name is ethyl 4-[bis[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[bis[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18348177 |
| Molecular Formula | C22H22F6N2O2 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | ethyl 4-[bis[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H22F6N2O2/c1-2-32-20(31)30-13-11-29(12-14-30)19(15-3-7-17(8-4-15)21(23,24)25)16-5-9-18(10-6-16)22(26,27)28/h3-10,19H,2,11-14H2,1H3 |
| InChIKey | UPJKOHRHTOZCDE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |