C16H17F3N4O2 — CID 54568628
ethyl 4-[6-(trifluoromethyl)cyclohepta[d]imidazol-2-yl]piperazine-1-carboxylate (PubChem CID 54568628) has the molecular formula C16H17F3N4O2 and a molecular weight of 354.33 g/mol. Its IUPAC name is ethyl 4-[6-(trifluoromethyl)cyclohepta[d]imidazol-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(trifluoromethyl)cyclohepta[d]imidazol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54568628 |
| Molecular Formula | C16H17F3N4O2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | ethyl 4-[6-(trifluoromethyl)cyclohepta[d]imidazol-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc3ccc(C(F)(F)F)ccc-3n2)CC1 |
| InChI | InChI=1S/C16H17F3N4O2/c1-2-25-15(24)23-9-7-22(8-10-23)14-20-12-5-3-11(16(17,18)19)4-6-13(12)21-14/h3-6H,2,7-10H2,1H3 |
| InChIKey | ZVPZCSCPRDCQHK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |