C18H24N6O2 — CID 112919741
ethyl 4-[4-methyl-6-(pyridin-4-ylmethylamino)pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 112919741) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is ethyl 4-[4-methyl-6-(pyridin-4-ylmethylamino)pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-methyl-6-(pyridin-4-ylmethylamino)pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112919741 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethyl 4-[4-methyl-6-(pyridin-4-ylmethylamino)pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc(C)cc(NCc3ccncc3)n2)CC1 |
| InChI | InChI=1S/C18H24N6O2/c1-3-26-18(25)24-10-8-23(9-11-24)17-21-14(2)12-16(22-17)20-13-15-4-6-19-7-5-15/h4-7,12H,3,8-11,13H2,1-2H3,(H,20,21,22) |
| InChIKey | CBASMIBTUXMAJU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |