C14H21N5O — CID 112907704
1-[4-[4-methyl-6-(prop-2-enylamino)pyrimidin-2-yl]piperazin-1-yl]ethanone (PubChem CID 112907704) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-[4-[4-methyl-6-(prop-2-enylamino)pyrimidin-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-methyl-6-(prop-2-enylamino)pyrimidin-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 112907704 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-[4-[4-methyl-6-(prop-2-enylamino)pyrimidin-2-yl]piperazin-1-yl]ethanone |
| SMILES | C=CCNc1cc(C)nc(N2CCN(C(C)=O)CC2)n1 |
| InChI | InChI=1S/C14H21N5O/c1-4-5-15-13-10-11(2)16-14(17-13)19-8-6-18(7-9-19)12(3)20/h4,10H,1,5-9H2,2-3H3,(H,15,16,17) |
| InChIKey | ASMQXMNESRSHDG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|