C12H18N6O — CID 112939499
1-[4-[5-(prop-2-enylamino)-1,2,4-triazin-3-yl]piperazin-1-yl]ethanone (PubChem CID 112939499) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 1-[4-[5-(prop-2-enylamino)-1,2,4-triazin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[5-(prop-2-enylamino)-1,2,4-triazin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 112939499 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-[4-[5-(prop-2-enylamino)-1,2,4-triazin-3-yl]piperazin-1-yl]ethanone |
| SMILES | C=CCNc1cnnc(N2CCN(C(C)=O)CC2)n1 |
| InChI | InChI=1S/C12H18N6O/c1-3-4-13-11-9-14-16-12(15-11)18-7-5-17(6-8-18)10(2)19/h3,9H,1,4-8H2,2H3,(H,13,15,16) |
| InChIKey | XKVPYXOCMNYHAP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|