C25H40N2O2 — CID 142475115
1-[2,6-dimethyl-6-(4-morpholin-4-ylphenyl)hept-2-en-4-yl]-4-methylpiperidin-4-ol (PubChem CID 142475115) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 1-[2,6-dimethyl-6-(4-morpholin-4-ylphenyl)hept-2-en-4-yl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[2,6-dimethyl-6-(4-morpholin-4-ylphenyl)hept-2-en-4-yl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 142475115 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | 1-[2,6-dimethyl-6-(4-morpholin-4-ylphenyl)hept-2-en-4-yl]-4-methylpiperidin-4-ol |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(N2CCOCC2)cc1)N1CCC(C)(O)CC1 |
| InChI | InChI=1S/C25H40N2O2/c1-20(2)18-23(26-12-10-25(5,28)11-13-26)19-24(3,4)21-6-8-22(9-7-21)27-14-16-29-17-15-27/h6-9,18,23,28H,10-17,19H2,1-5H3 |
| InChIKey | YGJJHQFXNBPFND-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|