C20H27FN2O2 — CID 92633437
2-(4-fluorophenyl)-2-methyl-1-[(3R)-3-(piperidine-1-carbonyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 92633437) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-methyl-1-[(3R)-3-(piperidine-1-carbonyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 2-(4-fluorophenyl)-2-methyl-1-[(3R)-3-(piperidine-1-carbonyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 92633437 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-(4-fluorophenyl)-2-methyl-1-[(3R)-3-(piperidine-1-carbonyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(C)(C(=O)N1CC[C@@H](C(=O)N2CCCCC2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN2O2/c1-20(2,16-6-8-17(21)9-7-16)19(25)23-13-10-15(14-23)18(24)22-11-4-3-5-12-22/h6-9,15H,3-5,10-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | QXIUQQJWNVPEJW-OAHLLOKOSA-N |
| XLogP | 2.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |