C21H30N4O3 — CID 51933994
(3R)-3-[4-(2-methyl-2-phenylpropanoyl)piperazine-1-carbonyl]piperidine-1-carboxamide (PubChem CID 51933994) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is (3R)-3-[4-(2-methyl-2-phenylpropanoyl)piperazine-1-carbonyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[4-(2-methyl-2-phenylpropanoyl)piperazine-1-carbonyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 51933994 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (3R)-3-[4-(2-methyl-2-phenylpropanoyl)piperazine-1-carbonyl]piperidine-1-carboxamide |
| SMILES | CC(C)(C(=O)N1CCN(C(=O)[C@@H]2CCCN(C(N)=O)C2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H30N4O3/c1-21(2,17-8-4-3-5-9-17)19(27)24-13-11-23(12-14-24)18(26)16-7-6-10-25(15-16)20(22)28/h3-5,8-9,16H,6-7,10-15H2,1-2H3,(H2,22,28)/t16-/m1/s1 |
| InChIKey | PKGBCRGMGDXASW-MRXNPFEDSA-N |
| XLogP | 1.43 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |