C20H27N3O3 — CID 52525158
(5R)-5-[4-(2-methyl-2-phenylpropanoyl)piperazine-1-carbonyl]piperidin-2-one (PubChem CID 52525158) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (5R)-5-[4-(2-methyl-2-phenylpropanoyl)piperazine-1-carbonyl]piperidin-2-one.
| Compound Name | (5R)-5-[4-(2-methyl-2-phenylpropanoyl)piperazine-1-carbonyl]piperidin-2-one |
|---|---|
| PubChem CID | 52525158 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (5R)-5-[4-(2-methyl-2-phenylpropanoyl)piperazine-1-carbonyl]piperidin-2-one |
| SMILES | CC(C)(C(=O)N1CCN(C(=O)[C@@H]2CCC(=O)NC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H27N3O3/c1-20(2,16-6-4-3-5-7-16)19(26)23-12-10-22(11-13-23)18(25)15-8-9-17(24)21-14-15/h3-7,15H,8-14H2,1-2H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | STEFGRJRHOVJRD-OAHLLOKOSA-N |
| XLogP | 1.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |