C12H21N3O2 — CID 112729081
5-(4-methyl-1,4-diazepane-1-carbonyl)piperidin-2-one (PubChem CID 112729081) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-(4-methyl-1,4-diazepane-1-carbonyl)piperidin-2-one.
| Compound Name | 5-(4-methyl-1,4-diazepane-1-carbonyl)piperidin-2-one |
|---|---|
| PubChem CID | 112729081 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 5-(4-methyl-1,4-diazepane-1-carbonyl)piperidin-2-one |
| SMILES | CN1CCCN(C(=O)C2CCC(=O)NC2)CC1 |
| InChI | InChI=1S/C12H21N3O2/c1-14-5-2-6-15(8-7-14)12(17)10-3-4-11(16)13-9-10/h10H,2-9H2,1H3,(H,13,16) |
| InChIKey | KZOMLNRSOZRMEB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |