C16H25N3O3 — CID 135090162
5-(4-pent-4-enoyl-1,4-diazepane-1-carbonyl)piperidin-2-one (PubChem CID 135090162) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 5-(4-pent-4-enoyl-1,4-diazepane-1-carbonyl)piperidin-2-one.
| Compound Name | 5-(4-pent-4-enoyl-1,4-diazepane-1-carbonyl)piperidin-2-one |
|---|---|
| PubChem CID | 135090162 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 5-(4-pent-4-enoyl-1,4-diazepane-1-carbonyl)piperidin-2-one |
| SMILES | C=CCCC(=O)N1CCCN(C(=O)C2CCC(=O)NC2)CC1 |
| InChI | InChI=1S/C16H25N3O3/c1-2-3-5-15(21)18-8-4-9-19(11-10-18)16(22)13-6-7-14(20)17-12-13/h2,13H,1,3-12H2,(H,17,20) |
| InChIKey | IENMMRYNSUOKCM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|