C24H29N3O2 — CID 97128394
(3S)-3-(3,3-diphenylpiperidine-1-carbonyl)piperidine-1-carboxamide (PubChem CID 97128394) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (3S)-3-(3,3-diphenylpiperidine-1-carbonyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-(3,3-diphenylpiperidine-1-carbonyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97128394 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (3S)-3-(3,3-diphenylpiperidine-1-carbonyl)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC[C@H](C(=O)N2CCCC(c3ccccc3)(c3ccccc3)C2)C1 |
| InChI | InChI=1S/C24H29N3O2/c25-23(29)26-15-7-9-19(17-26)22(28)27-16-8-14-24(18-27,20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-6,10-13,19H,7-9,14-18H2,(H2,25,29)/t19-/m0/s1 |
| InChIKey | KLZARMFGTHLDET-IBGZPJMESA-N |
| XLogP | 3.39 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |