C22H25N3O2 — CID 97134489
(6S)-6-(3,3-diphenylpiperidine-1-carbonyl)piperazin-2-one (PubChem CID 97134489) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (6S)-6-(3,3-diphenylpiperidine-1-carbonyl)piperazin-2-one.
| Compound Name | (6S)-6-(3,3-diphenylpiperidine-1-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 97134489 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (6S)-6-(3,3-diphenylpiperidine-1-carbonyl)piperazin-2-one |
| SMILES | O=C1CNC[C@@H](C(=O)N2CCCC(c3ccccc3)(c3ccccc3)C2)N1 |
| InChI | InChI=1S/C22H25N3O2/c26-20-15-23-14-19(24-20)21(27)25-13-7-12-22(16-25,17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,19,23H,7,12-16H2,(H,24,26)/t19-/m0/s1 |
| InChIKey | XBWFSWCKJSKMKI-IBGZPJMESA-N |
| XLogP | 1.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |