C22H22N2O — CID 72916779
(3,3-diphenylpiperidin-1-yl)-(1H-pyrrol-3-yl)methanone (PubChem CID 72916779) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is (3,3-diphenylpiperidin-1-yl)-(1H-pyrrol-3-yl)methanone.
| Compound Name | (3,3-diphenylpiperidin-1-yl)-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 72916779 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (3,3-diphenylpiperidin-1-yl)-(1H-pyrrol-3-yl)methanone |
| SMILES | O=C(c1cc[nH]c1)N1CCCC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C22H22N2O/c25-21(18-12-14-23-16-18)24-15-7-13-22(17-24,19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-12,14,16,23H,7,13,15,17H2 |
| InChIKey | RFPCEIMKCPXMQO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |