C23H23N3O — CID 72872127
(3,3-diphenylpiperidin-1-yl)-(5-methylpyrazin-2-yl)methanone (PubChem CID 72872127) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is (3,3-diphenylpiperidin-1-yl)-(5-methylpyrazin-2-yl)methanone.
| Compound Name | (3,3-diphenylpiperidin-1-yl)-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 72872127 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (3,3-diphenylpiperidin-1-yl)-(5-methylpyrazin-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2CCCC(c3ccccc3)(c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C23H23N3O/c1-18-15-25-21(16-24-18)22(27)26-14-8-13-23(17-26,19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-7,9-12,15-16H,8,13-14,17H2,1H3 |
| InChIKey | AEUBXIJLEGNWHN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |